C13H16ClNO4S — CID 76907150
3-[3-chloro-4-(diethylsulfamoyl)phenyl]prop-2-enoic acid (PubChem CID 76907150) has the molecular formula C13H16ClNO4S and a molecular weight of 317.79 g/mol. Its IUPAC name is 3-[3-chloro-4-(diethylsulfamoyl)phenyl]prop-2-enoic acid.
| Compound Name | 3-[3-chloro-4-(diethylsulfamoyl)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 76907150 |
| Molecular Formula | C13H16ClNO4S |
| Molecular Weight | 317.79 g/mol |
| Exact Mass | 317.05 |
| IUPAC Name | 3-[3-chloro-4-(diethylsulfamoyl)phenyl]prop-2-enoic acid |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(C=CC(=O)O)cc1Cl |
| InChI | InChI=1S/C13H16ClNO4S/c1-3-15(4-2)20(18,19)12-7-5-10(9-11(12)14)6-8-13(16)17/h5-9H,3-4H2,1-2H3,(H,16,17) |
| InChIKey | OZFLMPSNIZLHOC-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.79 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|