C14H18FNO4S — CID 116529873
(E)-3-[4-[ethyl(propan-2-yl)sulfamoyl]-3-fluorophenyl]prop-2-enoic acid (PubChem CID 116529873) has the molecular formula C14H18FNO4S and a molecular weight of 315.37 g/mol. Its IUPAC name is (E)-3-[4-[ethyl(propan-2-yl)sulfamoyl]-3-fluorophenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[ethyl(propan-2-yl)sulfamoyl]-3-fluorophenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 116529873 |
| Molecular Formula | C14H18FNO4S |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | (E)-3-[4-[ethyl(propan-2-yl)sulfamoyl]-3-fluorophenyl]prop-2-enoic acid |
| SMILES | CCN(C(C)C)S(=O)(=O)c1ccc(/C=C/C(=O)O)cc1F |
| InChI | InChI=1S/C14H18FNO4S/c1-4-16(10(2)3)21(19,20)13-7-5-11(9-12(13)15)6-8-14(17)18/h5-10H,4H2,1-3H3,(H,17,18)/b8-6+ |
| InChIKey | GNDVVDYRWQVTRT-SOFGYWHQSA-N |
| XLogP | 2.34 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|