C19H20ClNO4S — CID 113226952
(E)-3-[4-[benzyl(propan-2-yl)sulfamoyl]-3-chlorophenyl]prop-2-enoic acid (PubChem CID 113226952) has the molecular formula C19H20ClNO4S and a molecular weight of 393.89 g/mol. Its IUPAC name is (E)-3-[4-[benzyl(propan-2-yl)sulfamoyl]-3-chlorophenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[benzyl(propan-2-yl)sulfamoyl]-3-chlorophenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 113226952 |
| Molecular Formula | C19H20ClNO4S |
| Molecular Weight | 393.89 g/mol |
| Exact Mass | 393.08 |
| IUPAC Name | (E)-3-[4-[benzyl(propan-2-yl)sulfamoyl]-3-chlorophenyl]prop-2-enoic acid |
| SMILES | CC(C)N(Cc1ccccc1)S(=O)(=O)c1ccc(/C=C/C(=O)O)cc1Cl |
| InChI | InChI=1S/C19H20ClNO4S/c1-14(2)21(13-16-6-4-3-5-7-16)26(24,25)18-10-8-15(12-17(18)20)9-11-19(22)23/h3-12,14H,13H2,1-2H3,(H,22,23)/b11-9+ |
| InChIKey | SDSNRQKHJGPYBJ-PKNBQFBNSA-N |
| XLogP | 4.04 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.89 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|