C14H18ClNO4S — CID 76906900
3-[3-chloro-4-(3-methylbutylsulfamoyl)phenyl]prop-2-enoic acid (PubChem CID 76906900) has the molecular formula C14H18ClNO4S and a molecular weight of 331.82 g/mol. Its IUPAC name is 3-[3-chloro-4-(3-methylbutylsulfamoyl)phenyl]prop-2-enoic acid.
| Compound Name | 3-[3-chloro-4-(3-methylbutylsulfamoyl)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 76906900 |
| Molecular Formula | C14H18ClNO4S |
| Molecular Weight | 331.82 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | 3-[3-chloro-4-(3-methylbutylsulfamoyl)phenyl]prop-2-enoic acid |
| SMILES | CC(C)CCNS(=O)(=O)c1ccc(C=CC(=O)O)cc1Cl |
| InChI | InChI=1S/C14H18ClNO4S/c1-10(2)7-8-16-21(19,20)13-5-3-11(9-12(13)15)4-6-14(17)18/h3-6,9-10,16H,7-8H2,1-2H3,(H,17,18) |
| InChIKey | KQMSCTWZTGACST-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.82 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|