C11H11ClN2O5S — CID 76906865
3-[4-[(2-amino-2-oxoethyl)sulfamoyl]-3-chlorophenyl]prop-2-enoic acid (PubChem CID 76906865) has the molecular formula C11H11ClN2O5S and a molecular weight of 318.74 g/mol. Its IUPAC name is 3-[4-[(2-amino-2-oxoethyl)sulfamoyl]-3-chlorophenyl]prop-2-enoic acid.
| Compound Name | 3-[4-[(2-amino-2-oxoethyl)sulfamoyl]-3-chlorophenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 76906865 |
| Molecular Formula | C11H11ClN2O5S |
| Molecular Weight | 318.74 g/mol |
| Exact Mass | 318.01 |
| IUPAC Name | 3-[4-[(2-amino-2-oxoethyl)sulfamoyl]-3-chlorophenyl]prop-2-enoic acid |
| SMILES | NC(=O)CNS(=O)(=O)c1ccc(C=CC(=O)O)cc1Cl |
| InChI | InChI=1S/C11H11ClN2O5S/c12-8-5-7(2-4-11(16)17)1-3-9(8)20(18,19)14-6-10(13)15/h1-5,14H,6H2,(H2,13,15)(H,16,17) |
| InChIKey | KRDNIOOKAWLCJL-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 126.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.74 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|