C17H24FNO2 — CID 76998002
3-[4-[bis(2-methylpropyl)amino]-3-fluorophenyl]prop-2-enoic acid (PubChem CID 76998002) has the molecular formula C17H24FNO2 and a molecular weight of 293.38 g/mol. Its IUPAC name is 3-[4-[bis(2-methylpropyl)amino]-3-fluorophenyl]prop-2-enoic acid.
| Compound Name | 3-[4-[bis(2-methylpropyl)amino]-3-fluorophenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 76998002 |
| Molecular Formula | C17H24FNO2 |
| Molecular Weight | 293.38 g/mol |
| Exact Mass | 293.18 |
| IUPAC Name | 3-[4-[bis(2-methylpropyl)amino]-3-fluorophenyl]prop-2-enoic acid |
| SMILES | CC(C)CN(CC(C)C)c1ccc(C=CC(=O)O)cc1F |
| InChI | InChI=1S/C17H24FNO2/c1-12(2)10-19(11-13(3)4)16-7-5-14(9-15(16)18)6-8-17(20)21/h5-9,12-13H,10-11H2,1-4H3,(H,20,21) |
| InChIKey | OPMHSCMHSNRSBV-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.38 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|