C14H20ClNO — CID 78954482
(1R)-1-[3-chloro-4-[cyclopropylmethyl(ethyl)amino]phenyl]ethanol (PubChem CID 78954482) has the molecular formula C14H20ClNO and a molecular weight of 253.77 g/mol. Its IUPAC name is (1R)-1-[3-chloro-4-[cyclopropylmethyl(ethyl)amino]phenyl]ethanol.
| Compound Name | (1R)-1-[3-chloro-4-[cyclopropylmethyl(ethyl)amino]phenyl]ethanol |
|---|---|
| PubChem CID | 78954482 |
| Molecular Formula | C14H20ClNO |
| Molecular Weight | 253.77 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | (1R)-1-[3-chloro-4-[cyclopropylmethyl(ethyl)amino]phenyl]ethanol |
| SMILES | CCN(CC1CC1)c1ccc([C@@H](C)O)cc1Cl |
| InChI | InChI=1S/C14H20ClNO/c1-3-16(9-11-4-5-11)14-7-6-12(10(2)17)8-13(14)15/h6-8,10-11,17H,3-5,9H2,1-2H3/t10-/m1/s1 |
| InChIKey | GIHWGQGTAUMIPK-SNVBAGLBSA-N |
| XLogP | 3.63 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.77 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|