C16H26ClNO — CID 63540939
(1R)-1-[3-chloro-4-[ethyl(2-ethylbutyl)amino]phenyl]ethanol (PubChem CID 63540939) has the molecular formula C16H26ClNO and a molecular weight of 283.84 g/mol. Its IUPAC name is (1R)-1-[3-chloro-4-[ethyl(2-ethylbutyl)amino]phenyl]ethanol.
| Compound Name | (1R)-1-[3-chloro-4-[ethyl(2-ethylbutyl)amino]phenyl]ethanol |
|---|---|
| PubChem CID | 63540939 |
| Molecular Formula | C16H26ClNO |
| Molecular Weight | 283.84 g/mol |
| Exact Mass | 283.17 |
| IUPAC Name | (1R)-1-[3-chloro-4-[ethyl(2-ethylbutyl)amino]phenyl]ethanol |
| SMILES | CCC(CC)CN(CC)c1ccc([C@@H](C)O)cc1Cl |
| InChI | InChI=1S/C16H26ClNO/c1-5-13(6-2)11-18(7-3)16-9-8-14(12(4)19)10-15(16)17/h8-10,12-13,19H,5-7,11H2,1-4H3/t12-/m1/s1 |
| InChIKey | FKJMCUBPIPXPQL-GFCCVEGCSA-N |
| XLogP | 4.66 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.84 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|