C9H9NOS — CID 126677405
2,6-dimethyl-1,3-benzothiazol-5-ol (PubChem CID 126677405) has the molecular formula C9H9NOS and a molecular weight of 179.24 g/mol. Its IUPAC name is 2,6-dimethyl-1,3-benzothiazol-5-ol.
| Compound Name | 2,6-dimethyl-1,3-benzothiazol-5-ol |
|---|---|
| PubChem CID | 126677405 |
| Molecular Formula | C9H9NOS |
| Molecular Weight | 179.24 g/mol |
| Exact Mass | 179.04 |
| IUPAC Name | 2,6-dimethyl-1,3-benzothiazol-5-ol |
| SMILES | Cc1nc2cc(O)c(C)cc2s1 |
| InChI | InChI=1S/C9H9NOS/c1-5-3-9-7(4-8(5)11)10-6(2)12-9/h3-4,11H,1-2H3 |
| InChIKey | BUVRIPWRBXXDCJ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.24 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |