C32H24N4O4S4 — CID 157329405
2-methyl-5-(6-methyl-[1,3]thiazolo[4,5-f][1,3]benzothiazol-2-yl)benzene-1,4-diol;2-methyl-5-(6-methyl-[1,3]thiazolo[5,4-f][1,3]benzothiazol-2-yl)benzene-1,4-diol (PubChem CID 157329405) has the molecular formula C32H24N4O4S4 and a molecular weight of 656.84 g/mol. Its IUPAC name is 2-methyl-5-(6-methyl-[1,3]thiazolo[4,5-f][1,3]benzothiazol-2-yl)benzene-1,4-diol;2-methyl-5-(6-methyl-[1,3]thiazolo[5,4-f][1,3]benzothiazol-2-yl)benzene-1,4-diol.
| Compound Name | 2-methyl-5-(6-methyl-[1,3]thiazolo[4,5-f][1,3]benzothiazol-2-yl)benzene-1,4-diol;2-methyl-5-(6-methyl-[1,3]thiazolo[5,4-f][1,3]benzothiazol-2-yl)benzene-1,4-diol |
|---|---|
| PubChem CID | 157329405 |
| Molecular Formula | C32H24N4O4S4 |
| Molecular Weight | 656.84 g/mol |
| Exact Mass | 656.07 |
| IUPAC Name | 2-methyl-5-(6-methyl-[1,3]thiazolo[4,5-f][1,3]benzothiazol-2-yl)benzene-1,4-diol;2-methyl-5-(6-methyl-[1,3]thiazolo[5,4-f][1,3]benzothiazol-2-yl)benzene-1,4-diol |
| SMILES | Cc1nc2cc3nc(-c4cc(O)c(C)cc4O)sc3cc2s1.Cc1nc2cc3sc(-c4cc(O)c(C)cc4O)nc3cc2s1 |
| InChI | InChI=1S/2C16H12N2O2S2/c1-7-3-13(20)9(4-12(7)19)16-18-11-6-14-10(5-15(11)22-16)17-8(2)21-14;1-7-3-13(20)9(4-12(7)19)16-18-11-5-10-14(6-15(11)22-16)21-8(2)17-10/h2*3-6,19-20H,1-2H3 |
| InChIKey | BFCMKPPLCGQABG-UHFFFAOYSA-N |
| XLogP | 9.20 |
| TPSA | 132.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.84 |
| LogP ≤ 5 | 9.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|