C9H8BrNOS — CID 118134419
6-bromo-5-methoxy-2-methyl-1,3-benzothiazole (PubChem CID 118134419) has the molecular formula C9H8BrNOS and a molecular weight of 258.14 g/mol. Its IUPAC name is 6-bromo-5-methoxy-2-methyl-1,3-benzothiazole.
| Compound Name | 6-bromo-5-methoxy-2-methyl-1,3-benzothiazole |
|---|---|
| PubChem CID | 118134419 |
| Molecular Formula | C9H8BrNOS |
| Molecular Weight | 258.14 g/mol |
| Exact Mass | 256.95 |
| IUPAC Name | 6-bromo-5-methoxy-2-methyl-1,3-benzothiazole |
| SMILES | COc1cc2nc(C)sc2cc1Br |
| InChI | InChI=1S/C9H8BrNOS/c1-5-11-7-4-8(12-2)6(10)3-9(7)13-5/h3-4H,1-2H3 |
| InChIKey | OHWOXGUWJPXTMA-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.14 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |