C10H13NO3S — CID 51056765
5,6-dimethoxy-2-methyl-1,3-benzothiazole;hydrate (PubChem CID 51056765) has the molecular formula C10H13NO3S and a molecular weight of 227.28 g/mol. Its IUPAC name is 5,6-dimethoxy-2-methyl-1,3-benzothiazole;hydrate.
| Compound Name | 5,6-dimethoxy-2-methyl-1,3-benzothiazole;hydrate |
|---|---|
| PubChem CID | 51056765 |
| Molecular Formula | C10H13NO3S |
| Molecular Weight | 227.28 g/mol |
| Exact Mass | 227.06 |
| IUPAC Name | 5,6-dimethoxy-2-methyl-1,3-benzothiazole;hydrate |
| SMILES | COc1cc2nc(C)sc2cc1OC.O |
| InChI | InChI=1S/C10H11NO2S.H2O/c1-6-11-7-4-8(12-2)9(13-3)5-10(7)14-6;/h4-5H,1-3H3;1H2 |
| InChIKey | PPQTXRUQENJGEN-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 62.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.28 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |