C9H10N4S — CID 18697929
2-(2-methyl-1,3-benzothiazol-5-yl)guanidine (PubChem CID 18697929) has the molecular formula C9H10N4S and a molecular weight of 206.27 g/mol. Its IUPAC name is 2-(2-methyl-1,3-benzothiazol-5-yl)guanidine.
| Compound Name | 2-(2-methyl-1,3-benzothiazol-5-yl)guanidine |
|---|---|
| PubChem CID | 18697929 |
| Molecular Formula | C9H10N4S |
| Molecular Weight | 206.27 g/mol |
| Exact Mass | 206.06 |
| IUPAC Name | 2-(2-methyl-1,3-benzothiazol-5-yl)guanidine |
| SMILES | Cc1nc2cc(N=C(N)N)ccc2s1 |
| InChI | InChI=1S/C9H10N4S/c1-5-12-7-4-6(13-9(10)11)2-3-8(7)14-5/h2-4H,1H3,(H4,10,11,13) |
| InChIKey | QJLNNSPIQAPYLY-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 77.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.27 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|