C14H21N3S — CID 172595403
N-ethyl-2-methyl-N-pentyl-[1,3]thiazolo[4,5-c]pyridin-6-amine (PubChem CID 172595403) has the molecular formula C14H21N3S and a molecular weight of 263.41 g/mol. Its IUPAC name is N-ethyl-2-methyl-N-pentyl-[1,3]thiazolo[4,5-c]pyridin-6-amine.
| Compound Name | N-ethyl-2-methyl-N-pentyl-[1,3]thiazolo[4,5-c]pyridin-6-amine |
|---|---|
| PubChem CID | 172595403 |
| Molecular Formula | C14H21N3S |
| Molecular Weight | 263.41 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | N-ethyl-2-methyl-N-pentyl-[1,3]thiazolo[4,5-c]pyridin-6-amine |
| SMILES | CCCCCN(CC)c1cc2sc(C)nc2cn1 |
| InChI | InChI=1S/C14H21N3S/c1-4-6-7-8-17(5-2)14-9-13-12(10-15-14)16-11(3)18-13/h9-10H,4-8H2,1-3H3 |
| InChIKey | RYJAXVWBACDJQA-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.41 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|