C14H25N3 — CID 113381293
4-(aminomethyl)-N-butyl-N,6-diethylpyridin-2-amine (PubChem CID 113381293) has the molecular formula C14H25N3 and a molecular weight of 235.37 g/mol. Its IUPAC name is 4-(aminomethyl)-N-butyl-N,6-diethylpyridin-2-amine.
| Compound Name | 4-(aminomethyl)-N-butyl-N,6-diethylpyridin-2-amine |
|---|---|
| PubChem CID | 113381293 |
| Molecular Formula | C14H25N3 |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.20 |
| IUPAC Name | 4-(aminomethyl)-N-butyl-N,6-diethylpyridin-2-amine |
| SMILES | CCCCN(CC)c1cc(CN)cc(CC)n1 |
| InChI | InChI=1S/C14H25N3/c1-4-7-8-17(6-3)14-10-12(11-15)9-13(5-2)16-14/h9-10H,4-8,11,15H2,1-3H3 |
| InChIKey | BIVGWOQMSRFQAD-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |