C17H30ClN3 — CID 102996063
N'-[4-(chloromethyl)-6-ethyl-2-pyridinyl]-N,N,N'-triethylpropane-1,3-diamine (PubChem CID 102996063) has the molecular formula C17H30ClN3 and a molecular weight of 311.90 g/mol. Its IUPAC name is N'-[4-(chloromethyl)-6-ethyl-2-pyridinyl]-N,N,N'-triethylpropane-1,3-diamine.
| Compound Name | N'-[4-(chloromethyl)-6-ethyl-2-pyridinyl]-N,N,N'-triethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 102996063 |
| Molecular Formula | C17H30ClN3 |
| Molecular Weight | 311.90 g/mol |
| Exact Mass | 311.21 |
| IUPAC Name | N'-[4-(chloromethyl)-6-ethyl-2-pyridinyl]-N,N,N'-triethylpropane-1,3-diamine |
| SMILES | CCc1cc(CCl)cc(N(CC)CCCN(CC)CC)n1 |
| InChI | InChI=1S/C17H30ClN3/c1-5-16-12-15(14-18)13-17(19-16)21(8-4)11-9-10-20(6-2)7-3/h12-13H,5-11,14H2,1-4H3 |
| InChIKey | JNZMZROAMJTBSH-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.90 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|