About ethane;N-methyl-1-(2-methyl-1,3-benzothiazol-5-yl)methanamine
ethane;N-methyl-1-(2-methyl-1,3-benzothiazol-5-yl)methanamine (PubChem CID 162358300) has the molecular formula C12H18N2S
and a molecular weight of 222.36 g/mol. Its IUPAC name is ethane;N-methyl-1-(2-methyl-1,3-benzothiazol-5-yl)methanamine.
Molecular Properties
| Compound Name | ethane;N-methyl-1-(2-methyl-1,3-benzothiazol-5-yl)methanamine |
| PubChem CID | 162358300 |
| Molecular Formula | C12H18N2S |
| Molecular Weight | 222.36 g/mol |
| Exact Mass | 222.12 |
| IUPAC Name | ethane;N-methyl-1-(2-methyl-1,3-benzothiazol-5-yl)methanamine |
| SMILES | CC.CNCc1ccc2sc(C)nc2c1 |
| InChI | InChI=1S/C10H12N2S.C2H6/c1-7-12-9-5-8(6-11-2)3-4-10(9)13-7;1-2/h3-5,11H,6H2,1-2H3;1-2H3 |
| InChIKey | LEVLMRZQJTVCGM-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.36 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;N-methyl-1-(2-methyl-1,3-benzothiazol-5-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N-methyl-1-(2-methyl-1,3-benzothiazol-5-yl)methanamine?
The IUPAC name of ethane;N-methyl-1-(2-methyl-1,3-benzothiazol-5-yl)methanamine (CID 162358300) is ethane;N-methyl-1-(2-methyl-1,3-benzothiazol-5-yl)methanamine.
What is the SMILES notation for ethane;N-methyl-1-(2-methyl-1,3-benzothiazol-5-yl)methanamine?
The canonical SMILES for ethane;N-methyl-1-(2-methyl-1,3-benzothiazol-5-yl)methanamine is CC.CNCc1ccc2sc(C)nc2c1.
What is the InChIKey of ethane;N-methyl-1-(2-methyl-1,3-benzothiazol-5-yl)methanamine?
The InChIKey is LEVLMRZQJTVCGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2S.C2H6/c1-7-12-9-5-8(6-11-2)3-4-10(9)13-7;1-2/h3-5,11H,6H2,1-2H3;1-2H3.
What are the key properties of ethane;N-methyl-1-(2-methyl-1,3-benzothiazol-5-yl)methanamine?
ethane;N-methyl-1-(2-methyl-1,3-benzothiazol-5-yl)methanamine has a molecular weight of 222.36 g/mol, XLogP of 3.35, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N-methyl-1-(2-methyl-1,3-benzothiazol-5-yl)methanamine is sourced from PubChem (CID 162358300), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).