C7H3N7 — CID 102410296
2,4,6,7,11,12,14-heptazatricyclo[8.4.0.03,8]tetradeca-1,3(8),4,6,9,11,13-heptaene (PubChem CID 102410296) has the molecular formula C7H3N7 and a molecular weight of 185.15 g/mol. Its IUPAC name is 2,4,6,7,11,12,14-heptazatricyclo[8.4.0.03,8]tetradeca-1,3(8),4,6,9,11,13-heptaene.
| Compound Name | 2,4,6,7,11,12,14-heptazatricyclo[8.4.0.03,8]tetradeca-1,3(8),4,6,9,11,13-heptaene |
|---|---|
| PubChem CID | 102410296 |
| Molecular Formula | C7H3N7 |
| Molecular Weight | 185.15 g/mol |
| Exact Mass | 185.04 |
| IUPAC Name | 2,4,6,7,11,12,14-heptazatricyclo[8.4.0.03,8]tetradeca-1,3(8),4,6,9,11,13-heptaene |
| SMILES | c1nnc2cc3nncnc3nc2n1 |
| InChI | InChI=1S/C7H3N7/c1-4-6(8-2-10-13-4)12-7-5(1)14-11-3-9-7/h1-3H |
| InChIKey | RFJUWPLQLAKXSP-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 90.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.15 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|