C15H7N7 — CID 102403996
2,4,6,8,18,20,22-heptazapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(22),2,4,6,8,10,12,14,16,18,20-undecaene (PubChem CID 102403996) has the molecular formula C15H7N7 and a molecular weight of 285.27 g/mol. Its IUPAC name is 2,4,6,8,18,20,22-heptazapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(22),2,4,6,8,10,12,14,16,18,20-undecaene.
| Compound Name | 2,4,6,8,18,20,22-heptazapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(22),2,4,6,8,10,12,14,16,18,20-undecaene |
|---|---|
| PubChem CID | 102403996 |
| Molecular Formula | C15H7N7 |
| Molecular Weight | 285.27 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | 2,4,6,8,18,20,22-heptazapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(22),2,4,6,8,10,12,14,16,18,20-undecaene |
| SMILES | c1ncc2cc3cc4cc5cncnc5nc4nc3nc2n1 |
| InChI | InChI=1S/C15H7N7/c1-8-2-10-4-16-6-18-12(10)20-14(8)22-15-9(1)3-11-5-17-7-19-13(11)21-15/h1-7H |
| InChIKey | NZBASFYEJYAMIL-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 90.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.27 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|