C10H10N4O — CID 155057011
7-nitroso-6-propan-2-ylpyrido[2,3-d]pyrimidine (PubChem CID 155057011) has the molecular formula C10H10N4O and a molecular weight of 202.22 g/mol. Its IUPAC name is 7-nitroso-6-propan-2-ylpyrido[2,3-d]pyrimidine.
| Compound Name | 7-nitroso-6-propan-2-ylpyrido[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 155057011 |
| Molecular Formula | C10H10N4O |
| Molecular Weight | 202.22 g/mol |
| Exact Mass | 202.09 |
| IUPAC Name | 7-nitroso-6-propan-2-ylpyrido[2,3-d]pyrimidine |
| SMILES | CC(C)c1cc2cncnc2nc1N=O |
| InChI | InChI=1S/C10H10N4O/c1-6(2)8-3-7-4-11-5-12-9(7)13-10(8)14-15/h3-6H,1-2H3 |
| InChIKey | FLVYEIMEIRAPHX-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 68.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.22 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |