About 6-propan-2-ylpteridine
6-propan-2-ylpteridine (PubChem CID 59283430) has the molecular formula C9H10N4
and a molecular weight of 174.21 g/mol. Its IUPAC name is 6-propan-2-ylpteridine.
Molecular Properties
| Compound Name | 6-propan-2-ylpteridine |
| PubChem CID | 59283430 |
| Molecular Formula | C9H10N4 |
| Molecular Weight | 174.21 g/mol |
| Exact Mass | 174.09 |
| IUPAC Name | 6-propan-2-ylpteridine |
| SMILES | CC(C)c1cnc2ncncc2n1 |
| InChI | InChI=1S/C9H10N4/c1-6(2)7-4-11-9-8(13-7)3-10-5-12-9/h3-6H,1-2H3 |
| InChIKey | RUXWJRCTFPHHGI-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.21 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-propan-2-ylpteridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-propan-2-ylpteridine?
The IUPAC name of 6-propan-2-ylpteridine (CID 59283430) is 6-propan-2-ylpteridine.
What is the SMILES notation for 6-propan-2-ylpteridine?
The canonical SMILES for 6-propan-2-ylpteridine is CC(C)c1cnc2ncncc2n1.
What is the InChIKey of 6-propan-2-ylpteridine?
The InChIKey is RUXWJRCTFPHHGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N4/c1-6(2)7-4-11-9-8(13-7)3-10-5-12-9/h3-6H,1-2H3.
What are the key properties of 6-propan-2-ylpteridine?
6-propan-2-ylpteridine has a molecular weight of 174.21 g/mol, XLogP of 1.54, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-propan-2-ylpteridine is sourced from PubChem (CID 59283430), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).