About N-pyrimido[4,5-c]pyridazin-3-ylacetamide
N-pyrimido[4,5-c]pyridazin-3-ylacetamide (PubChem CID 68759802) has the molecular formula C8H7N5O
and a molecular weight of 189.18 g/mol. Its IUPAC name is N-pyrimido[4,5-c]pyridazin-3-ylacetamide.
Molecular Properties
| Compound Name | N-pyrimido[4,5-c]pyridazin-3-ylacetamide |
| PubChem CID | 68759802 |
| Molecular Formula | C8H7N5O |
| Molecular Weight | 189.18 g/mol |
| Exact Mass | 189.07 |
| IUPAC Name | N-pyrimido[4,5-c]pyridazin-3-ylacetamide |
| SMILES | CC(=O)Nc1cc2cncnc2nn1 |
| InChI | InChI=1S/C8H7N5O/c1-5(14)11-7-2-6-3-9-4-10-8(6)13-12-7/h2-4H,1H3,(H,11,12,14) |
| InChIKey | MNYWWBIJBGARLW-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 80.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.18 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-pyrimido[4,5-c]pyridazin-3-ylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-pyrimido[4,5-c]pyridazin-3-ylacetamide?
The IUPAC name of N-pyrimido[4,5-c]pyridazin-3-ylacetamide (CID 68759802) is N-pyrimido[4,5-c]pyridazin-3-ylacetamide.
What is the SMILES notation for N-pyrimido[4,5-c]pyridazin-3-ylacetamide?
The canonical SMILES for N-pyrimido[4,5-c]pyridazin-3-ylacetamide is CC(=O)Nc1cc2cncnc2nn1.
What is the InChIKey of N-pyrimido[4,5-c]pyridazin-3-ylacetamide?
The InChIKey is MNYWWBIJBGARLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N5O/c1-5(14)11-7-2-6-3-9-4-10-8(6)13-12-7/h2-4H,1H3,(H,11,12,14).
What are the key properties of N-pyrimido[4,5-c]pyridazin-3-ylacetamide?
N-pyrimido[4,5-c]pyridazin-3-ylacetamide has a molecular weight of 189.18 g/mol, XLogP of 0.38, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-pyrimido[4,5-c]pyridazin-3-ylacetamide is sourced from PubChem (CID 68759802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).