About 4-methyl-3-pyrido[2,3-d]pyrimidin-6-ylaniline
4-methyl-3-pyrido[2,3-d]pyrimidin-6-ylaniline (PubChem CID 155718233) has the molecular formula C14H12N4
and a molecular weight of 236.28 g/mol. Its IUPAC name is 4-methyl-3-pyrido[2,3-d]pyrimidin-6-ylaniline.
Molecular Properties
| Compound Name | 4-methyl-3-pyrido[2,3-d]pyrimidin-6-ylaniline |
| PubChem CID | 155718233 |
| Molecular Formula | C14H12N4 |
| Molecular Weight | 236.28 g/mol |
| Exact Mass | 236.11 |
| IUPAC Name | 4-methyl-3-pyrido[2,3-d]pyrimidin-6-ylaniline |
| SMILES | Cc1ccc(N)cc1-c1cnc2ncncc2c1 |
| InChI | InChI=1S/C14H12N4/c1-9-2-3-12(15)5-13(9)10-4-11-6-16-8-18-14(11)17-7-10/h2-8H,15H2,1H3 |
| InChIKey | UQHHVIKUGYZCOM-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.28 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-3-pyrido[2,3-d]pyrimidin-6-ylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-3-pyrido[2,3-d]pyrimidin-6-ylaniline?
The IUPAC name of 4-methyl-3-pyrido[2,3-d]pyrimidin-6-ylaniline (CID 155718233) is 4-methyl-3-pyrido[2,3-d]pyrimidin-6-ylaniline.
What is the SMILES notation for 4-methyl-3-pyrido[2,3-d]pyrimidin-6-ylaniline?
The canonical SMILES for 4-methyl-3-pyrido[2,3-d]pyrimidin-6-ylaniline is Cc1ccc(N)cc1-c1cnc2ncncc2c1.
What is the InChIKey of 4-methyl-3-pyrido[2,3-d]pyrimidin-6-ylaniline?
The InChIKey is UQHHVIKUGYZCOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12N4/c1-9-2-3-12(15)5-13(9)10-4-11-6-16-8-18-14(11)17-7-10/h2-8H,15H2,1H3.
What are the key properties of 4-methyl-3-pyrido[2,3-d]pyrimidin-6-ylaniline?
4-methyl-3-pyrido[2,3-d]pyrimidin-6-ylaniline has a molecular weight of 236.28 g/mol, XLogP of 2.58, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-3-pyrido[2,3-d]pyrimidin-6-ylaniline is sourced from PubChem (CID 155718233), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).