C13H9IN4 — CID 12904755
6-(2-iodophenyl)pyrido[2,3-d]pyrimidin-7-amine (PubChem CID 12904755) has the molecular formula C13H9IN4 and a molecular weight of 348.15 g/mol. Its IUPAC name is 6-(2-iodophenyl)pyrido[2,3-d]pyrimidin-7-amine.
| Compound Name | 6-(2-iodophenyl)pyrido[2,3-d]pyrimidin-7-amine |
|---|---|
| PubChem CID | 12904755 |
| Molecular Formula | C13H9IN4 |
| Molecular Weight | 348.15 g/mol |
| Exact Mass | 347.99 |
| IUPAC Name | 6-(2-iodophenyl)pyrido[2,3-d]pyrimidin-7-amine |
| SMILES | Nc1nc2ncncc2cc1-c1ccccc1I |
| InChI | InChI=1S/C13H9IN4/c14-11-4-2-1-3-9(11)10-5-8-6-16-7-17-13(8)18-12(10)15/h1-7H,(H2,15,16,17,18) |
| InChIKey | LLDJCMXWHQVTPR-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.15 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|