C17H11N3 — CID 168908169
7-naphthalen-1-ylpyrido[4,3-d]pyrimidine (PubChem CID 168908169) has the molecular formula C17H11N3 and a molecular weight of 257.30 g/mol. Its IUPAC name is 7-naphthalen-1-ylpyrido[4,3-d]pyrimidine.
| Compound Name | 7-naphthalen-1-ylpyrido[4,3-d]pyrimidine |
|---|---|
| PubChem CID | 168908169 |
| Molecular Formula | C17H11N3 |
| Molecular Weight | 257.30 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | 7-naphthalen-1-ylpyrido[4,3-d]pyrimidine |
| SMILES | c1ccc2c(-c3cc4ncncc4cn3)cccc2c1 |
| InChI | InChI=1S/C17H11N3/c1-2-6-14-12(4-1)5-3-7-15(14)17-8-16-13(10-19-17)9-18-11-20-16/h1-11H |
| InChIKey | KYIPJKYNYVKERD-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.30 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |