C10H9IN4 — CID 79918939
4-N-(2-iodophenyl)pyrimidine-4,5-diamine (PubChem CID 79918939) has the molecular formula C10H9IN4 and a molecular weight of 312.11 g/mol. Its IUPAC name is 4-N-(2-iodophenyl)pyrimidine-4,5-diamine.
| Compound Name | 4-N-(2-iodophenyl)pyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 79918939 |
| Molecular Formula | C10H9IN4 |
| Molecular Weight | 312.11 g/mol |
| Exact Mass | 311.99 |
| IUPAC Name | 4-N-(2-iodophenyl)pyrimidine-4,5-diamine |
| SMILES | Nc1cncnc1Nc1ccccc1I |
| InChI | InChI=1S/C10H9IN4/c11-7-3-1-2-4-9(7)15-10-8(12)5-13-6-14-10/h1-6H,12H2,(H,13,14,15) |
| InChIKey | TXTSSELYAFETQX-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.11 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|