C12H4N10 — CID 101411498
2,4,6,9,11,13,15,17,20,22-decazapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1,3,5,7,9,11,13,15,17,19,21-undecaene (PubChem CID 101411498) has the molecular formula C12H4N10 and a molecular weight of 288.23 g/mol. Its IUPAC name is 2,4,6,9,11,13,15,17,20,22-decazapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1,3,5,7,9,11,13,15,17,19,21-undecaene.
| Compound Name | 2,4,6,9,11,13,15,17,20,22-decazapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1,3,5,7,9,11,13,15,17,19,21-undecaene |
|---|---|
| PubChem CID | 101411498 |
| Molecular Formula | C12H4N10 |
| Molecular Weight | 288.23 g/mol |
| Exact Mass | 288.06 |
| IUPAC Name | 2,4,6,9,11,13,15,17,20,22-decazapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1,3,5,7,9,11,13,15,17,19,21-undecaene |
| SMILES | c1cnc2nc3nc4nc5nccnc5nc4nc3nc2n1 |
| InChI | InChI=1S/C12H4N10/c1-2-14-6-5(13-1)17-9-10(18-6)22-12-11(21-9)19-7-8(20-12)16-4-3-15-7/h1-4H |
| InChIKey | RJQOKJGGHMAIHE-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 128.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.23 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|