C4H3N5O — CID 69177004
3-hydroxytriazolo[4,5-b]pyrazine (PubChem CID 69177004) has the molecular formula C4H3N5O and a molecular weight of 137.10 g/mol. Its IUPAC name is 3-hydroxytriazolo[4,5-b]pyrazine.
| Compound Name | 3-hydroxytriazolo[4,5-b]pyrazine |
|---|---|
| PubChem CID | 69177004 |
| Molecular Formula | C4H3N5O |
| Molecular Weight | 137.10 g/mol |
| Exact Mass | 137.03 |
| IUPAC Name | 3-hydroxytriazolo[4,5-b]pyrazine |
| SMILES | On1nnc2nccnc21 |
| InChI | InChI=1S/C4H3N5O/c10-9-4-3(7-8-9)5-1-2-6-4/h1-2,10H |
| InChIKey | KYSFVEXPTGQRPP-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.10 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|