About 3-hydroxytriazolo[4,5-b]pyrazine
3-hydroxytriazolo[4,5-b]pyrazine (PubChem CID 69177004) has the molecular formula C4H3N5O
and a molecular weight of 137.10 g/mol. Its IUPAC name is 3-hydroxytriazolo[4,5-b]pyrazine.
Molecular Properties
| Compound Name | 3-hydroxytriazolo[4,5-b]pyrazine |
| PubChem CID | 69177004 |
| Molecular Formula | C4H3N5O |
| Molecular Weight | 137.10 g/mol |
| Exact Mass | 137.03 |
| IUPAC Name | 3-hydroxytriazolo[4,5-b]pyrazine |
| SMILES | On1nnc2nccnc21 |
| InChI | InChI=1S/C4H3N5O/c10-9-4-3(7-8-9)5-1-2-6-4/h1-2,10H |
| InChIKey | KYSFVEXPTGQRPP-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.10 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 3-hydroxytriazolo[4,5-b]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxytriazolo[4,5-b]pyrazine?
The IUPAC name of 3-hydroxytriazolo[4,5-b]pyrazine (CID 69177004) is 3-hydroxytriazolo[4,5-b]pyrazine.
What is the SMILES notation for 3-hydroxytriazolo[4,5-b]pyrazine?
The canonical SMILES for 3-hydroxytriazolo[4,5-b]pyrazine is On1nnc2nccnc21.
What is the InChIKey of 3-hydroxytriazolo[4,5-b]pyrazine?
The InChIKey is KYSFVEXPTGQRPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H3N5O/c10-9-4-3(7-8-9)5-1-2-6-4/h1-2,10H.
What are the key properties of 3-hydroxytriazolo[4,5-b]pyrazine?
3-hydroxytriazolo[4,5-b]pyrazine has a molecular weight of 137.10 g/mol, XLogP of -0.54, 0 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxytriazolo[4,5-b]pyrazine is sourced from PubChem (CID 69177004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).