About 2-methoxy-3-methylimidazo[4,5-b]pyrazine
2-methoxy-3-methylimidazo[4,5-b]pyrazine (PubChem CID 131860790) has the molecular formula C7H8N4O
and a molecular weight of 164.17 g/mol. Its IUPAC name is 2-methoxy-3-methylimidazo[4,5-b]pyrazine.
Molecular Properties
| Compound Name | 2-methoxy-3-methylimidazo[4,5-b]pyrazine |
| PubChem CID | 131860790 |
| Molecular Formula | C7H8N4O |
| Molecular Weight | 164.17 g/mol |
| Exact Mass | 164.07 |
| IUPAC Name | 2-methoxy-3-methylimidazo[4,5-b]pyrazine |
| SMILES | COc1nc2nccnc2n1C |
| InChI | InChI=1S/C7H8N4O/c1-11-6-5(8-3-4-9-6)10-7(11)12-2/h3-4H,1-2H3 |
| InChIKey | ZCROKYCPVGUUFV-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.17 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-methoxy-3-methylimidazo[4,5-b]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-3-methylimidazo[4,5-b]pyrazine?
The IUPAC name of 2-methoxy-3-methylimidazo[4,5-b]pyrazine (CID 131860790) is 2-methoxy-3-methylimidazo[4,5-b]pyrazine.
What is the SMILES notation for 2-methoxy-3-methylimidazo[4,5-b]pyrazine?
The canonical SMILES for 2-methoxy-3-methylimidazo[4,5-b]pyrazine is COc1nc2nccnc2n1C.
What is the InChIKey of 2-methoxy-3-methylimidazo[4,5-b]pyrazine?
The InChIKey is ZCROKYCPVGUUFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N4O/c1-11-6-5(8-3-4-9-6)10-7(11)12-2/h3-4H,1-2H3.
What are the key properties of 2-methoxy-3-methylimidazo[4,5-b]pyrazine?
2-methoxy-3-methylimidazo[4,5-b]pyrazine has a molecular weight of 164.17 g/mol, XLogP of 0.37, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-3-methylimidazo[4,5-b]pyrazine is sourced from PubChem (CID 131860790), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).