C12H18N6O — CID 131720865
N,N'-di(propan-2-yl)methanediimine;3-hydroxytriazolo[4,5-b]pyridine (PubChem CID 131720865) has the molecular formula C12H18N6O and a molecular weight of 262.32 g/mol. Its IUPAC name is N,N'-di(propan-2-yl)methanediimine;3-hydroxytriazolo[4,5-b]pyridine.
| Compound Name | N,N'-di(propan-2-yl)methanediimine;3-hydroxytriazolo[4,5-b]pyridine |
|---|---|
| PubChem CID | 131720865 |
| Molecular Formula | C12H18N6O |
| Molecular Weight | 262.32 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | N,N'-di(propan-2-yl)methanediimine;3-hydroxytriazolo[4,5-b]pyridine |
| SMILES | CC(C)N=C=NC(C)C.On1nnc2cccnc21 |
| InChI | InChI=1S/C7H14N2.C5H4N4O/c1-6(2)8-5-9-7(3)4;10-9-5-4(7-8-9)2-1-3-6-5/h6-7H,1-4H3;1-3,10H |
| InChIKey | PPVWPUFYWHNCLM-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 88.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.32 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|