C20H18O — CID 171717400
4-[3,4-bis(ethenyl)phenoxy]-1,2-bis(ethenyl)benzene (PubChem CID 171717400) has the molecular formula C20H18O and a molecular weight of 274.36 g/mol. Its IUPAC name is 4-[3,4-bis(ethenyl)phenoxy]-1,2-bis(ethenyl)benzene.
| Compound Name | 4-[3,4-bis(ethenyl)phenoxy]-1,2-bis(ethenyl)benzene |
|---|---|
| PubChem CID | 171717400 |
| Molecular Formula | C20H18O |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | 4-[3,4-bis(ethenyl)phenoxy]-1,2-bis(ethenyl)benzene |
| SMILES | C=Cc1ccc(Oc2ccc(C=C)c(C=C)c2)cc1C=C |
| InChI | InChI=1S/C20H18O/c1-5-15-9-11-19(13-17(15)7-3)21-20-12-10-16(6-2)18(8-4)14-20/h5-14H,1-4H2 |
| InChIKey | LDCCBYDATRXGMA-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |