C14H16 — CID 154450625
4-but-1-enyl-1,2-bis(ethenyl)benzene (PubChem CID 154450625) has the molecular formula C14H16 and a molecular weight of 184.28 g/mol. Its IUPAC name is 4-but-1-enyl-1,2-bis(ethenyl)benzene.
| Compound Name | 4-but-1-enyl-1,2-bis(ethenyl)benzene |
|---|---|
| PubChem CID | 154450625 |
| Molecular Formula | C14H16 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.13 |
| IUPAC Name | 4-but-1-enyl-1,2-bis(ethenyl)benzene |
| SMILES | C=Cc1ccc(C=CCC)cc1C=C |
| InChI | InChI=1S/C14H16/c1-4-7-8-12-9-10-13(5-2)14(6-3)11-12/h5-11H,2-4H2,1H3 |
| InChIKey | KDSQLOYNMJVYRQ-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |