About 4-but-1-enyl-1,2-bis(ethenyl)benzene
4-but-1-enyl-1,2-bis(ethenyl)benzene (PubChem CID 154450625) has the molecular formula C14H16
and a molecular weight of 184.28 g/mol. Its IUPAC name is 4-but-1-enyl-1,2-bis(ethenyl)benzene.
Molecular Properties
| Compound Name | 4-but-1-enyl-1,2-bis(ethenyl)benzene |
| PubChem CID | 154450625 |
| Molecular Formula | C14H16 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.13 |
| IUPAC Name | 4-but-1-enyl-1,2-bis(ethenyl)benzene |
| SMILES | C=Cc1ccc(C=CCC)cc1C=C |
| InChI | InChI=1S/C14H16/c1-4-7-8-12-9-10-13(5-2)14(6-3)11-12/h5-11H,2-4H2,1H3 |
| InChIKey | KDSQLOYNMJVYRQ-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 4-but-1-enyl-1,2-bis(ethenyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-but-1-enyl-1,2-bis(ethenyl)benzene?
The IUPAC name of 4-but-1-enyl-1,2-bis(ethenyl)benzene (CID 154450625) is 4-but-1-enyl-1,2-bis(ethenyl)benzene.
What is the SMILES notation for 4-but-1-enyl-1,2-bis(ethenyl)benzene?
The canonical SMILES for 4-but-1-enyl-1,2-bis(ethenyl)benzene is C=Cc1ccc(C=CCC)cc1C=C.
What is the InChIKey of 4-but-1-enyl-1,2-bis(ethenyl)benzene?
The InChIKey is KDSQLOYNMJVYRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16/c1-4-7-8-12-9-10-13(5-2)14(6-3)11-12/h5-11H,2-4H2,1H3.
What are the key properties of 4-but-1-enyl-1,2-bis(ethenyl)benzene?
4-but-1-enyl-1,2-bis(ethenyl)benzene has a molecular weight of 184.28 g/mol, XLogP of 4.40, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-but-1-enyl-1,2-bis(ethenyl)benzene is sourced from PubChem (CID 154450625), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).