C12H14O — CID 142802318
1,2-bis(ethenyl)-4-ethoxybenzene (PubChem CID 142802318) has the molecular formula C12H14O and a molecular weight of 174.24 g/mol. Its IUPAC name is 1,2-bis(ethenyl)-4-ethoxybenzene.
| Compound Name | 1,2-bis(ethenyl)-4-ethoxybenzene |
|---|---|
| PubChem CID | 142802318 |
| Molecular Formula | C12H14O |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.10 |
| IUPAC Name | 1,2-bis(ethenyl)-4-ethoxybenzene |
| SMILES | C=Cc1ccc(OCC)cc1C=C |
| InChI | InChI=1S/C12H14O/c1-4-10-7-8-12(13-6-3)9-11(10)5-2/h4-5,7-9H,1-2,6H2,3H3 |
| InChIKey | AKYAZKGLOFCYSQ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |