C20H22O3 — CID 167053134
1-ethenyl-2-[2-ethenyl-5-(ethoxymethoxy)phenyl]-4-methoxybenzene (PubChem CID 167053134) has the molecular formula C20H22O3 and a molecular weight of 310.39 g/mol. Its IUPAC name is 1-ethenyl-2-[2-ethenyl-5-(ethoxymethoxy)phenyl]-4-methoxybenzene.
| Compound Name | 1-ethenyl-2-[2-ethenyl-5-(ethoxymethoxy)phenyl]-4-methoxybenzene |
|---|---|
| PubChem CID | 167053134 |
| Molecular Formula | C20H22O3 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.16 |
| IUPAC Name | 1-ethenyl-2-[2-ethenyl-5-(ethoxymethoxy)phenyl]-4-methoxybenzene |
| SMILES | C=Cc1ccc(OC)cc1-c1cc(OCOCC)ccc1C=C |
| InChI | InChI=1S/C20H22O3/c1-5-15-8-10-17(21-4)12-19(15)20-13-18(23-14-22-7-3)11-9-16(20)6-2/h5-6,8-13H,1-2,7,14H2,3-4H3 |
| InChIKey | UAXQJDVDCSSHBN-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|