C11H15NO — CID 170076614
2-ethenyl-5-methoxy-N,N-dimethylaniline (PubChem CID 170076614) has the molecular formula C11H15NO and a molecular weight of 177.25 g/mol. Its IUPAC name is 2-ethenyl-5-methoxy-N,N-dimethylaniline.
| Compound Name | 2-ethenyl-5-methoxy-N,N-dimethylaniline |
|---|---|
| PubChem CID | 170076614 |
| Molecular Formula | C11H15NO |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.12 |
| IUPAC Name | 2-ethenyl-5-methoxy-N,N-dimethylaniline |
| SMILES | C=Cc1ccc(OC)cc1N(C)C |
| InChI | InChI=1S/C11H15NO/c1-5-9-6-7-10(13-4)8-11(9)12(2)3/h5-8H,1H2,2-4H3 |
| InChIKey | JATGIZAOLSJZPB-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |