C15H16N2 — CID 145142376
2-ethenyl-N,N-dimethyl-5-pyridin-4-ylaniline (PubChem CID 145142376) has the molecular formula C15H16N2 and a molecular weight of 224.31 g/mol. Its IUPAC name is 2-ethenyl-N,N-dimethyl-5-pyridin-4-ylaniline.
| Compound Name | 2-ethenyl-N,N-dimethyl-5-pyridin-4-ylaniline |
|---|---|
| PubChem CID | 145142376 |
| Molecular Formula | C15H16N2 |
| Molecular Weight | 224.31 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | 2-ethenyl-N,N-dimethyl-5-pyridin-4-ylaniline |
| SMILES | C=Cc1ccc(-c2ccncc2)cc1N(C)C |
| InChI | InChI=1S/C15H16N2/c1-4-12-5-6-14(11-15(12)17(2)3)13-7-9-16-10-8-13/h4-11H,1H2,2-3H3 |
| InChIKey | RXXJXYYVPGXMDF-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.31 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |