C13H21N — CID 23348993
N-methyl-2,4-dipropylaniline (PubChem CID 23348993) has the molecular formula C13H21N and a molecular weight of 191.32 g/mol. Its IUPAC name is N-methyl-2,4-dipropylaniline.
| Compound Name | N-methyl-2,4-dipropylaniline |
|---|---|
| PubChem CID | 23348993 |
| Molecular Formula | C13H21N |
| Molecular Weight | 191.32 g/mol |
| Exact Mass | 191.17 |
| IUPAC Name | N-methyl-2,4-dipropylaniline |
| SMILES | CCCc1ccc(NC)c(CCC)c1 |
| InChI | InChI=1S/C13H21N/c1-4-6-11-8-9-13(14-3)12(10-11)7-5-2/h8-10,14H,4-7H2,1-3H3 |
| InChIKey | INKVIQOOUCQTBX-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.32 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |