About N-methyl-2,4-dipropylaniline
N-methyl-2,4-dipropylaniline (PubChem CID 23348993) has the molecular formula C13H21N
and a molecular weight of 191.32 g/mol. Its IUPAC name is N-methyl-2,4-dipropylaniline.
Molecular Properties
| Compound Name | N-methyl-2,4-dipropylaniline |
| PubChem CID | 23348993 |
| Molecular Formula | C13H21N |
| Molecular Weight | 191.32 g/mol |
| Exact Mass | 191.17 |
| IUPAC Name | N-methyl-2,4-dipropylaniline |
| SMILES | CCCc1ccc(NC)c(CCC)c1 |
| InChI | InChI=1S/C13H21N/c1-4-6-11-8-9-13(14-3)12(10-11)7-5-2/h8-10,14H,4-7H2,1-3H3 |
| InChIKey | INKVIQOOUCQTBX-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.32 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-methyl-2,4-dipropylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-2,4-dipropylaniline?
The IUPAC name of N-methyl-2,4-dipropylaniline (CID 23348993) is N-methyl-2,4-dipropylaniline.
What is the SMILES notation for N-methyl-2,4-dipropylaniline?
The canonical SMILES for N-methyl-2,4-dipropylaniline is CCCc1ccc(NC)c(CCC)c1.
What is the InChIKey of N-methyl-2,4-dipropylaniline?
The InChIKey is INKVIQOOUCQTBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21N/c1-4-6-11-8-9-13(14-3)12(10-11)7-5-2/h8-10,14H,4-7H2,1-3H3.
What are the key properties of N-methyl-2,4-dipropylaniline?
N-methyl-2,4-dipropylaniline has a molecular weight of 191.32 g/mol, XLogP of 3.63, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-2,4-dipropylaniline is sourced from PubChem (CID 23348993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).