About acetonitrile;1-butyl-2-ethenylbenzene
acetonitrile;1-butyl-2-ethenylbenzene (PubChem CID 18674742) has the molecular formula C14H19N
and a molecular weight of 201.31 g/mol. Its IUPAC name is acetonitrile;1-butyl-2-ethenylbenzene.
Molecular Properties
| Compound Name | acetonitrile;1-butyl-2-ethenylbenzene |
| PubChem CID | 18674742 |
| Molecular Formula | C14H19N |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | acetonitrile;1-butyl-2-ethenylbenzene |
| SMILES | C=Cc1ccccc1CCCC.CC#N |
| InChI | InChI=1S/C12H16.C2H3N/c1-3-5-8-12-10-7-6-9-11(12)4-2;1-2-3/h4,6-7,9-10H,2-3,5,8H2,1H3;1H3 |
| InChIKey | WRZGZYKWSMABJM-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze acetonitrile;1-butyl-2-ethenylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetonitrile;1-butyl-2-ethenylbenzene?
The IUPAC name of acetonitrile;1-butyl-2-ethenylbenzene (CID 18674742) is acetonitrile;1-butyl-2-ethenylbenzene.
What is the SMILES notation for acetonitrile;1-butyl-2-ethenylbenzene?
The canonical SMILES for acetonitrile;1-butyl-2-ethenylbenzene is C=Cc1ccccc1CCCC.CC#N.
What is the InChIKey of acetonitrile;1-butyl-2-ethenylbenzene?
The InChIKey is WRZGZYKWSMABJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16.C2H3N/c1-3-5-8-12-10-7-6-9-11(12)4-2;1-2-3/h4,6-7,9-10H,2-3,5,8H2,1H3;1H3.
What are the key properties of acetonitrile;1-butyl-2-ethenylbenzene?
acetonitrile;1-butyl-2-ethenylbenzene has a molecular weight of 201.31 g/mol, XLogP of 4.20, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for acetonitrile;1-butyl-2-ethenylbenzene is sourced from PubChem (CID 18674742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).