C16H24O3 — CID 174381438
1-butyl-2-ethenylbenzene;2-ethoxyacetic acid (PubChem CID 174381438) has the molecular formula C16H24O3 and a molecular weight of 264.37 g/mol. Its IUPAC name is 1-butyl-2-ethenylbenzene;2-ethoxyacetic acid.
| Compound Name | 1-butyl-2-ethenylbenzene;2-ethoxyacetic acid |
|---|---|
| PubChem CID | 174381438 |
| Molecular Formula | C16H24O3 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | 1-butyl-2-ethenylbenzene;2-ethoxyacetic acid |
| SMILES | C=Cc1ccccc1CCCC.CCOCC(=O)O |
| InChI | InChI=1S/C12H16.C4H8O3/c1-3-5-8-12-10-7-6-9-11(12)4-2;1-2-7-3-4(5)6/h4,6-7,9-10H,2-3,5,8H2,1H3;2-3H2,1H3,(H,5,6) |
| InChIKey | QQMXIRLLIFROQF-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |