C35H43Cl — CID 70369539
1,2-bis(ethenyl)benzene;3-chloroprop-1-enylbenzene;1-ethenyl-4-octylbenzene (PubChem CID 70369539) has the molecular formula C35H43Cl and a molecular weight of 499.18 g/mol. Its IUPAC name is 1,2-bis(ethenyl)benzene;3-chloroprop-1-enylbenzene;1-ethenyl-4-octylbenzene.
| Compound Name | 1,2-bis(ethenyl)benzene;3-chloroprop-1-enylbenzene;1-ethenyl-4-octylbenzene |
|---|---|
| PubChem CID | 70369539 |
| Molecular Formula | C35H43Cl |
| Molecular Weight | 499.18 g/mol |
| Exact Mass | 498.31 |
| IUPAC Name | 1,2-bis(ethenyl)benzene;3-chloroprop-1-enylbenzene;1-ethenyl-4-octylbenzene |
| SMILES | C=Cc1ccc(CCCCCCCC)cc1.C=Cc1ccccc1C=C.ClCC=Cc1ccccc1 |
| InChI | InChI=1S/C16H24.C10H10.C9H9Cl/c1-3-5-6-7-8-9-10-16-13-11-15(4-2)12-14-16;1-3-9-7-5-6-8-10(9)4-2;10-8-4-7-9-5-2-1-3-6-9/h4,11-14H,2-3,5-10H2,1H3;3-8H,1-2H2;1-7H,8H2 |
| InChIKey | HDAIAPUJPXDKJR-UHFFFAOYSA-N |
| XLogP | 11.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.18 |
| LogP ≤ 5 | 11.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|