C14H19NO — CID 122394792
2-(2-ethenylphenyl)-N,N-diethylacetamide (PubChem CID 122394792) has the molecular formula C14H19NO and a molecular weight of 217.31 g/mol. Its IUPAC name is 2-(2-ethenylphenyl)-N,N-diethylacetamide.
| Compound Name | 2-(2-ethenylphenyl)-N,N-diethylacetamide |
|---|---|
| PubChem CID | 122394792 |
| Molecular Formula | C14H19NO |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | 2-(2-ethenylphenyl)-N,N-diethylacetamide |
| SMILES | C=Cc1ccccc1CC(=O)N(CC)CC |
| InChI | InChI=1S/C14H19NO/c1-4-12-9-7-8-10-13(12)11-14(16)15(5-2)6-3/h4,7-10H,1,5-6,11H2,2-3H3 |
| InChIKey | CMQNBTNFAFHNOO-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |