C14H19NS2 — CID 71350969
(2-ethenylphenyl)methyl N,N-diethylcarbamodithioate (PubChem CID 71350969) has the molecular formula C14H19NS2 and a molecular weight of 265.45 g/mol. Its IUPAC name is (2-ethenylphenyl)methyl N,N-diethylcarbamodithioate.
| Compound Name | (2-ethenylphenyl)methyl N,N-diethylcarbamodithioate |
|---|---|
| PubChem CID | 71350969 |
| Molecular Formula | C14H19NS2 |
| Molecular Weight | 265.45 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | (2-ethenylphenyl)methyl N,N-diethylcarbamodithioate |
| SMILES | C=Cc1ccccc1CSC(=S)N(CC)CC |
| InChI | InChI=1S/C14H19NS2/c1-4-12-9-7-8-10-13(12)11-17-14(16)15(5-2)6-3/h4,7-10H,1,5-6,11H2,2-3H3 |
| InChIKey | IFOXPCORZHHQBS-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.45 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|