C14H18N4S2 — CID 27914144
(4-aminoquinazolin-2-yl)methyl N,N-diethylcarbamodithioate (PubChem CID 27914144) has the molecular formula C14H18N4S2 and a molecular weight of 306.46 g/mol. Its IUPAC name is (4-aminoquinazolin-2-yl)methyl N,N-diethylcarbamodithioate.
| Compound Name | (4-aminoquinazolin-2-yl)methyl N,N-diethylcarbamodithioate |
|---|---|
| PubChem CID | 27914144 |
| Molecular Formula | C14H18N4S2 |
| Molecular Weight | 306.46 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | (4-aminoquinazolin-2-yl)methyl N,N-diethylcarbamodithioate |
| SMILES | CCN(CC)C(=S)SCc1nc(N)c2ccccc2n1 |
| InChI | InChI=1S/C14H18N4S2/c1-3-18(4-2)14(19)20-9-12-16-11-8-6-5-7-10(11)13(15)17-12/h5-8H,3-4,9H2,1-2H3,(H2,15,16,17) |
| InChIKey | UUNDPMAGCKUMGX-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.46 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|