C15H24O2Si — CID 19006567
3-(3-ethenylphenoxy)propyl-ethoxy-dimethylsilane (PubChem CID 19006567) has the molecular formula C15H24O2Si and a molecular weight of 264.44 g/mol. Its IUPAC name is 3-(3-ethenylphenoxy)propyl-ethoxy-dimethylsilane.
| Compound Name | 3-(3-ethenylphenoxy)propyl-ethoxy-dimethylsilane |
|---|---|
| PubChem CID | 19006567 |
| Molecular Formula | C15H24O2Si |
| Molecular Weight | 264.44 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | 3-(3-ethenylphenoxy)propyl-ethoxy-dimethylsilane |
| SMILES | C=Cc1cccc(OCCC[Si](C)(C)OCC)c1 |
| InChI | InChI=1S/C15H24O2Si/c1-5-14-9-7-10-15(13-14)16-11-8-12-18(3,4)17-6-2/h5,7,9-10,13H,1,6,8,11-12H2,2-4H3 |
| InChIKey | FZDKXCLGUNBDRF-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.44 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|