C20H36O2Si2 — CID 174111811
butyl-[[3-(3-ethenylphenoxy)propyl-dimethylsilyl]methoxy]-dimethylsilane (PubChem CID 174111811) has the molecular formula C20H36O2Si2 and a molecular weight of 364.68 g/mol. Its IUPAC name is butyl-[[3-(3-ethenylphenoxy)propyl-dimethylsilyl]methoxy]-dimethylsilane.
| Compound Name | butyl-[[3-(3-ethenylphenoxy)propyl-dimethylsilyl]methoxy]-dimethylsilane |
|---|---|
| PubChem CID | 174111811 |
| Molecular Formula | C20H36O2Si2 |
| Molecular Weight | 364.68 g/mol |
| Exact Mass | 364.23 |
| IUPAC Name | butyl-[[3-(3-ethenylphenoxy)propyl-dimethylsilyl]methoxy]-dimethylsilane |
| SMILES | C=Cc1cccc(OCCC[Si](C)(C)CO[Si](C)(C)CCCC)c1 |
| InChI | InChI=1S/C20H36O2Si2/c1-7-9-16-24(5,6)22-18-23(3,4)15-11-14-21-20-13-10-12-19(8-2)17-20/h8,10,12-13,17H,2,7,9,11,14-16,18H2,1,3-6H3 |
| InChIKey | BEVNHBLOFXWNRF-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.68 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|