C18H29NO — CID 68645781
4-(3-ethenylphenoxy)-N,N-dipropylbutan-1-amine (PubChem CID 68645781) has the molecular formula C18H29NO and a molecular weight of 275.44 g/mol. Its IUPAC name is 4-(3-ethenylphenoxy)-N,N-dipropylbutan-1-amine.
| Compound Name | 4-(3-ethenylphenoxy)-N,N-dipropylbutan-1-amine |
|---|---|
| PubChem CID | 68645781 |
| Molecular Formula | C18H29NO |
| Molecular Weight | 275.44 g/mol |
| Exact Mass | 275.22 |
| IUPAC Name | 4-(3-ethenylphenoxy)-N,N-dipropylbutan-1-amine |
| SMILES | C=Cc1cccc(OCCCCN(CCC)CCC)c1 |
| InChI | InChI=1S/C18H29NO/c1-4-12-19(13-5-2)14-7-8-15-20-18-11-9-10-17(6-3)16-18/h6,9-11,16H,3-5,7-8,12-15H2,1-2H3 |
| InChIKey | OKJYMHZYHSBKJG-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.44 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|