C17H25NO — CID 2267298
4-(3-methylphenoxy)-N,N-bis(prop-2-enyl)butan-1-amine (PubChem CID 2267298) has the molecular formula C17H25NO and a molecular weight of 259.39 g/mol. Its IUPAC name is 4-(3-methylphenoxy)-N,N-bis(prop-2-enyl)butan-1-amine.
| Compound Name | 4-(3-methylphenoxy)-N,N-bis(prop-2-enyl)butan-1-amine |
|---|---|
| PubChem CID | 2267298 |
| Molecular Formula | C17H25NO |
| Molecular Weight | 259.39 g/mol |
| Exact Mass | 259.19 |
| IUPAC Name | 4-(3-methylphenoxy)-N,N-bis(prop-2-enyl)butan-1-amine |
| SMILES | C=CCN(CC=C)CCCCOc1cccc(C)c1 |
| InChI | InChI=1S/C17H25NO/c1-4-11-18(12-5-2)13-6-7-14-19-17-10-8-9-16(3)15-17/h4-5,8-10,15H,1-2,6-7,11-14H2,3H3 |
| InChIKey | QRRJKZZAEBXBLD-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.39 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|