C24H33NO2 — CID 67859793
3-[4-[(E)-2-(3-methoxyphenyl)ethenyl]phenoxy]-N,N-dipropylpropan-1-amine (PubChem CID 67859793) has the molecular formula C24H33NO2 and a molecular weight of 367.53 g/mol. Its IUPAC name is 3-[4-[(E)-2-(3-methoxyphenyl)ethenyl]phenoxy]-N,N-dipropylpropan-1-amine.
| Compound Name | 3-[4-[(E)-2-(3-methoxyphenyl)ethenyl]phenoxy]-N,N-dipropylpropan-1-amine |
|---|---|
| PubChem CID | 67859793 |
| Molecular Formula | C24H33NO2 |
| Molecular Weight | 367.53 g/mol |
| Exact Mass | 367.25 |
| IUPAC Name | 3-[4-[(E)-2-(3-methoxyphenyl)ethenyl]phenoxy]-N,N-dipropylpropan-1-amine |
| SMILES | CCCN(CCC)CCCOc1ccc(/C=C/c2cccc(OC)c2)cc1 |
| InChI | InChI=1S/C24H33NO2/c1-4-16-25(17-5-2)18-7-19-27-23-14-12-21(13-15-23)10-11-22-8-6-9-24(20-22)26-3/h6,8-15,20H,4-5,7,16-19H2,1-3H3/b11-10+ |
| InChIKey | QPPPQEFEUHEMBN-ZHACJKMWSA-N |
| XLogP | 5.76 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.53 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|