C17H29NO — CID 68645274
1-ethenyl-3-pentoxybenzene;N-ethylethanamine (PubChem CID 68645274) has the molecular formula C17H29NO and a molecular weight of 263.43 g/mol. Its IUPAC name is 1-ethenyl-3-pentoxybenzene;N-ethylethanamine.
| Compound Name | 1-ethenyl-3-pentoxybenzene;N-ethylethanamine |
|---|---|
| PubChem CID | 68645274 |
| Molecular Formula | C17H29NO |
| Molecular Weight | 263.43 g/mol |
| Exact Mass | 263.22 |
| IUPAC Name | 1-ethenyl-3-pentoxybenzene;N-ethylethanamine |
| SMILES | C=Cc1cccc(OCCCCC)c1.CCNCC |
| InChI | InChI=1S/C13H18O.C4H11N/c1-3-5-6-10-14-13-9-7-8-12(4-2)11-13;1-3-5-4-2/h4,7-9,11H,2-3,5-6,10H2,1H3;5H,3-4H2,1-2H3 |
| InChIKey | OESGUZNMGWPAHE-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.43 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|