C18H32Cl2O2Si2 — CID 90027286
chloro-[3-[[3-[3-[chloro(dimethyl)silyl]propoxymethyl]phenyl]methoxy]propyl]-dimethylsilane (PubChem CID 90027286) has the molecular formula C18H32Cl2O2Si2 and a molecular weight of 407.53 g/mol. Its IUPAC name is chloro-[3-[[3-[3-[chloro(dimethyl)silyl]propoxymethyl]phenyl]methoxy]propyl]-dimethylsilane.
| Compound Name | chloro-[3-[[3-[3-[chloro(dimethyl)silyl]propoxymethyl]phenyl]methoxy]propyl]-dimethylsilane |
|---|---|
| PubChem CID | 90027286 |
| Molecular Formula | C18H32Cl2O2Si2 |
| Molecular Weight | 407.53 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | chloro-[3-[[3-[3-[chloro(dimethyl)silyl]propoxymethyl]phenyl]methoxy]propyl]-dimethylsilane |
| SMILES | C[Si](C)(Cl)CCCOCc1cccc(COCCC[Si](C)(C)Cl)c1 |
| InChI | InChI=1S/C18H32Cl2O2Si2/c1-23(2,19)12-6-10-21-15-17-8-5-9-18(14-17)16-22-11-7-13-24(3,4)20/h5,8-9,14H,6-7,10-13,15-16H2,1-4H3 |
| InChIKey | BCLXYYSPWRIYDT-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.53 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|